C30H31N5O — CID 118717407
1-methyl-N-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butyl]-9H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 118717407) has the molecular formula C30H31N5O and a molecular weight of 477.61 g/mol. Its IUPAC name is 1-methyl-N-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butyl]-9H-pyrido[3,4-b]indole-3-carboxamide.
| Compound Name | 1-methyl-N-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butyl]-9H-pyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 118717407 |
| Molecular Formula | C30H31N5O |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | 1-methyl-N-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butyl]-9H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | Cc1nc(C(=O)NCCCCNc2c3c(nc4ccccc24)CCCC3)cc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C30H31N5O/c1-19-28-23(20-10-2-5-13-24(20)35-28)18-27(33-19)30(36)32-17-9-8-16-31-29-21-11-3-6-14-25(21)34-26-15-7-4-12-22(26)29/h2-3,5-6,10-11,13-14,18,35H,4,7-9,12,15-17H2,1H3,(H,31,34)(H,32,36) |
| InChIKey | XEPUHYVPCYWYRB-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|