C33H37N5O — CID 118717405
1-ethyl-N-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]-9H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 118717405) has the molecular formula C33H37N5O and a molecular weight of 519.69 g/mol. Its IUPAC name is 1-ethyl-N-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]-9H-pyrido[3,4-b]indole-3-carboxamide.
| Compound Name | 1-ethyl-N-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]-9H-pyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 118717405 |
| Molecular Formula | C33H37N5O |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.30 |
| IUPAC Name | 1-ethyl-N-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]-9H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | CCc1nc(C(=O)NCCCCCCNc2c3c(nc4ccccc24)CCCC3)cc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C33H37N5O/c1-2-26-32-25(22-13-5-8-16-27(22)38-32)21-30(36-26)33(39)35-20-12-4-3-11-19-34-31-23-14-6-9-17-28(23)37-29-18-10-7-15-24(29)31/h5-6,8-9,13-14,16-17,21,38H,2-4,7,10-12,15,18-20H2,1H3,(H,34,37)(H,35,39) |
| InChIKey | WUZJRHKAIFSDMM-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|