C27H29N3O — CID 122387165
(2E,4E)-5-phenyl-N-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propyl]penta-2,4-dienamide (PubChem CID 122387165) has the molecular formula C27H29N3O and a molecular weight of 411.55 g/mol. Its IUPAC name is (2E,4E)-5-phenyl-N-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propyl]penta-2,4-dienamide.
| Compound Name | (2E,4E)-5-phenyl-N-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 122387165 |
| Molecular Formula | C27H29N3O |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | (2E,4E)-5-phenyl-N-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propyl]penta-2,4-dienamide |
| SMILES | O=C(/C=C/C=C/c1ccccc1)NCCCNc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C27H29N3O/c31-26(18-9-4-13-21-11-2-1-3-12-21)28-19-10-20-29-27-22-14-5-7-16-24(22)30-25-17-8-6-15-23(25)27/h1-5,7,9,11-14,16,18H,6,8,10,15,17,19-20H2,(H,28,31)(H,29,30)/b13-4+,18-9+ |
| InChIKey | CFZGEZVGCNQJFD-QKRAZLJLSA-N |
| XLogP | 5.30 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|