C21H27N3O2S — CID 66549587
S-[1-oxo-1-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propylamino]propan-2-yl] ethanethioate (PubChem CID 66549587) has the molecular formula C21H27N3O2S and a molecular weight of 385.53 g/mol. Its IUPAC name is S-[1-oxo-1-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propylamino]propan-2-yl] ethanethioate.
| Compound Name | S-[1-oxo-1-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propylamino]propan-2-yl] ethanethioate |
|---|---|
| PubChem CID | 66549587 |
| Molecular Formula | C21H27N3O2S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | S-[1-oxo-1-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propylamino]propan-2-yl] ethanethioate |
| SMILES | CC(=O)SC(C)C(=O)NCCCNc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C21H27N3O2S/c1-14(27-15(2)25)21(26)23-13-7-12-22-20-16-8-3-5-10-18(16)24-19-11-6-4-9-17(19)20/h3,5,8,10,14H,4,6-7,9,11-13H2,1-2H3,(H,22,24)(H,23,26) |
| InChIKey | NVCGDEVDAAYYJT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|