C31H41N5O3 — CID 177378450
benzyl N-[(5S)-5-amino-6-oxo-6-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butylamino]hexyl]carbamate (PubChem CID 177378450) has the molecular formula C31H41N5O3 and a molecular weight of 531.70 g/mol. Its IUPAC name is benzyl N-[(5S)-5-amino-6-oxo-6-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butylamino]hexyl]carbamate.
| Compound Name | benzyl N-[(5S)-5-amino-6-oxo-6-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butylamino]hexyl]carbamate |
|---|---|
| PubChem CID | 177378450 |
| Molecular Formula | C31H41N5O3 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.32 |
| IUPAC Name | benzyl N-[(5S)-5-amino-6-oxo-6-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butylamino]hexyl]carbamate |
| SMILES | N[C@@H](CCCCNC(=O)OCc1ccccc1)C(=O)NCCCCNc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C31H41N5O3/c32-26(16-8-9-21-35-31(38)39-22-23-12-2-1-3-13-23)30(37)34-20-11-10-19-33-29-24-14-4-6-17-27(24)36-28-18-7-5-15-25(28)29/h1-4,6,12-14,17,26H,5,7-11,15-16,18-22,32H2,(H,33,36)(H,34,37)(H,35,38)/t26-/m0/s1 |
| InChIKey | TXKAUCJKPFGKDZ-SANMLTNESA-N |
| XLogP | 4.85 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|