C32H42N4O3 — CID 177378434
tert-butyl N-[(2S)-1-oxo-3-phenyl-1-[5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentylamino]propan-2-yl]carbamate (PubChem CID 177378434) has the molecular formula C32H42N4O3 and a molecular weight of 530.71 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-oxo-3-phenyl-1-[5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentylamino]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-oxo-3-phenyl-1-[5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentylamino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 177378434 |
| Molecular Formula | C32H42N4O3 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.33 |
| IUPAC Name | tert-butyl N-[(2S)-1-oxo-3-phenyl-1-[5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentylamino]propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)C(=O)NCCCCCNc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C32H42N4O3/c1-32(2,3)39-31(38)36-28(22-23-14-6-4-7-15-23)30(37)34-21-13-5-12-20-33-29-24-16-8-10-18-26(24)35-27-19-11-9-17-25(27)29/h4,6-8,10,14-16,18,28H,5,9,11-13,17,19-22H2,1-3H3,(H,33,35)(H,34,37)(H,36,38)/t28-/m0/s1 |
| InChIKey | TUWPYQGVEGGDFL-NDEPHWFRSA-N |
| XLogP | 5.95 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|