C22H27N3O2 — CID 11291507
tert-butyl N-[4-(acridin-9-ylamino)butyl]carbamate (PubChem CID 11291507) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is tert-butyl N-[4-(acridin-9-ylamino)butyl]carbamate.
| Compound Name | tert-butyl N-[4-(acridin-9-ylamino)butyl]carbamate |
|---|---|
| PubChem CID | 11291507 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | tert-butyl N-[4-(acridin-9-ylamino)butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCNc1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C22H27N3O2/c1-22(2,3)27-21(26)24-15-9-8-14-23-20-16-10-4-6-12-18(16)25-19-13-7-5-11-17(19)20/h4-7,10-13H,8-9,14-15H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | JPIUWGUZEPGOIJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|