C15H21N5O2 — CID 103204542
tert-butyl N-[3-(1,2,4-benzotriazin-3-ylamino)propyl]carbamate (PubChem CID 103204542) has the molecular formula C15H21N5O2 and a molecular weight of 303.37 g/mol. Its IUPAC name is tert-butyl N-[3-(1,2,4-benzotriazin-3-ylamino)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(1,2,4-benzotriazin-3-ylamino)propyl]carbamate |
|---|---|
| PubChem CID | 103204542 |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | tert-butyl N-[3-(1,2,4-benzotriazin-3-ylamino)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNc1nnc2ccccc2n1 |
| InChI | InChI=1S/C15H21N5O2/c1-15(2,3)22-14(21)17-10-6-9-16-13-18-11-7-4-5-8-12(11)19-20-13/h4-5,7-8H,6,9-10H2,1-3H3,(H,17,21)(H,16,18,20) |
| InChIKey | LHFWLJDSPCMUCB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|