C12H19IN4O2 — CID 104843546
tert-butyl N-[3-[(5-iodopyrimidin-2-yl)amino]propyl]carbamate (PubChem CID 104843546) has the molecular formula C12H19IN4O2 and a molecular weight of 378.21 g/mol. Its IUPAC name is tert-butyl N-[3-[(5-iodopyrimidin-2-yl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(5-iodopyrimidin-2-yl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 104843546 |
| Molecular Formula | C12H19IN4O2 |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | tert-butyl N-[3-[(5-iodopyrimidin-2-yl)amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNc1ncc(I)cn1 |
| InChI | InChI=1S/C12H19IN4O2/c1-12(2,3)19-11(18)15-6-4-5-14-10-16-7-9(13)8-17-10/h7-8H,4-6H2,1-3H3,(H,15,18)(H,14,16,17) |
| InChIKey | CLOSDHYICVWDHX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|