C17H22ClN5O2 — CID 118429513
tert-butyl N-[3-[[5-(2-chloro-4-pyridinyl)pyrimidin-2-yl]amino]propyl]carbamate (PubChem CID 118429513) has the molecular formula C17H22ClN5O2 and a molecular weight of 363.85 g/mol. Its IUPAC name is tert-butyl N-[3-[[5-(2-chloro-4-pyridinyl)pyrimidin-2-yl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[5-(2-chloro-4-pyridinyl)pyrimidin-2-yl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 118429513 |
| Molecular Formula | C17H22ClN5O2 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | tert-butyl N-[3-[[5-(2-chloro-4-pyridinyl)pyrimidin-2-yl]amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNc1ncc(-c2ccnc(Cl)c2)cn1 |
| InChI | InChI=1S/C17H22ClN5O2/c1-17(2,3)25-16(24)21-7-4-6-20-15-22-10-13(11-23-15)12-5-8-19-14(18)9-12/h5,8-11H,4,6-7H2,1-3H3,(H,21,24)(H,20,22,23) |
| InChIKey | WOVGMOKWIBRZPZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|