C20H26FN5O4 — CID 58777640
tert-butyl N-[3-[[4-amino-5-(5-fluoro-2-methoxybenzoyl)pyrimidin-2-yl]amino]propyl]carbamate (PubChem CID 58777640) has the molecular formula C20H26FN5O4 and a molecular weight of 419.46 g/mol. Its IUPAC name is tert-butyl N-[3-[[4-amino-5-(5-fluoro-2-methoxybenzoyl)pyrimidin-2-yl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[4-amino-5-(5-fluoro-2-methoxybenzoyl)pyrimidin-2-yl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 58777640 |
| Molecular Formula | C20H26FN5O4 |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | tert-butyl N-[3-[[4-amino-5-(5-fluoro-2-methoxybenzoyl)pyrimidin-2-yl]amino]propyl]carbamate |
| SMILES | COc1ccc(F)cc1C(=O)c1cnc(NCCCNC(=O)OC(C)(C)C)nc1N |
| InChI | InChI=1S/C20H26FN5O4/c1-20(2,3)30-19(28)24-9-5-8-23-18-25-11-14(17(22)26-18)16(27)13-10-12(21)6-7-15(13)29-4/h6-7,10-11H,5,8-9H2,1-4H3,(H,24,28)(H3,22,23,25,26) |
| InChIKey | PUHZSBBUVNHLAC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|