C21H27ClFN5O2S — CID 142928826
[4-amino-2-[[1-(4-chlorobutylsulfanyl)piperidin-4-yl]amino]pyrimidin-5-yl]-(5-fluoro-2-methoxyphenyl)methanone (PubChem CID 142928826) has the molecular formula C21H27ClFN5O2S and a molecular weight of 468.00 g/mol. Its IUPAC name is [4-amino-2-[[1-(4-chlorobutylsulfanyl)piperidin-4-yl]amino]pyrimidin-5-yl]-(5-fluoro-2-methoxyphenyl)methanone.
| Compound Name | [4-amino-2-[[1-(4-chlorobutylsulfanyl)piperidin-4-yl]amino]pyrimidin-5-yl]-(5-fluoro-2-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 142928826 |
| Molecular Formula | C21H27ClFN5O2S |
| Molecular Weight | 468.00 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | [4-amino-2-[[1-(4-chlorobutylsulfanyl)piperidin-4-yl]amino]pyrimidin-5-yl]-(5-fluoro-2-methoxyphenyl)methanone |
| SMILES | COc1ccc(F)cc1C(=O)c1cnc(NC2CCN(SCCCCCl)CC2)nc1N |
| InChI | InChI=1S/C21H27ClFN5O2S/c1-30-18-5-4-14(23)12-16(18)19(29)17-13-25-21(27-20(17)24)26-15-6-9-28(10-7-15)31-11-3-2-8-22/h4-5,12-13,15H,2-3,6-11H2,1H3,(H3,24,25,26,27) |
| InChIKey | LRGREGILFKQDKF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.00 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|