C23H31FN6O3 — CID 87885896
2-[4-[[4-amino-5-(5-fluoro-2-methoxybenzoyl)pyrimidin-2-yl]amino]piperidin-1-yl]-2-(diethylamino)acetaldehyde (PubChem CID 87885896) has the molecular formula C23H31FN6O3 and a molecular weight of 458.54 g/mol. Its IUPAC name is 2-[4-[[4-amino-5-(5-fluoro-2-methoxybenzoyl)pyrimidin-2-yl]amino]piperidin-1-yl]-2-(diethylamino)acetaldehyde.
| Compound Name | 2-[4-[[4-amino-5-(5-fluoro-2-methoxybenzoyl)pyrimidin-2-yl]amino]piperidin-1-yl]-2-(diethylamino)acetaldehyde |
|---|---|
| PubChem CID | 87885896 |
| Molecular Formula | C23H31FN6O3 |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | 2-[4-[[4-amino-5-(5-fluoro-2-methoxybenzoyl)pyrimidin-2-yl]amino]piperidin-1-yl]-2-(diethylamino)acetaldehyde |
| SMILES | CCN(CC)C(C=O)N1CCC(Nc2ncc(C(=O)c3cc(F)ccc3OC)c(N)n2)CC1 |
| InChI | InChI=1S/C23H31FN6O3/c1-4-29(5-2)20(14-31)30-10-8-16(9-11-30)27-23-26-13-18(22(25)28-23)21(32)17-12-15(24)6-7-19(17)33-3/h6-7,12-14,16,20H,4-5,8-11H2,1-3H3,(H3,25,26,27,28) |
| InChIKey | YRXQOQWUKYIBPL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|