C16H20FN5O2 — CID 21070548
[4-amino-2-(4-aminobutylamino)pyrimidin-5-yl]-(5-fluoro-2-methoxyphenyl)methanone (PubChem CID 21070548) has the molecular formula C16H20FN5O2 and a molecular weight of 333.37 g/mol. Its IUPAC name is [4-amino-2-(4-aminobutylamino)pyrimidin-5-yl]-(5-fluoro-2-methoxyphenyl)methanone.
| Compound Name | [4-amino-2-(4-aminobutylamino)pyrimidin-5-yl]-(5-fluoro-2-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 21070548 |
| Molecular Formula | C16H20FN5O2 |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | [4-amino-2-(4-aminobutylamino)pyrimidin-5-yl]-(5-fluoro-2-methoxyphenyl)methanone |
| SMILES | COc1ccc(F)cc1C(=O)c1cnc(NCCCCN)nc1N |
| InChI | InChI=1S/C16H20FN5O2/c1-24-13-5-4-10(17)8-11(13)14(23)12-9-21-16(22-15(12)19)20-7-3-2-6-18/h4-5,8-9H,2-3,6-7,18H2,1H3,(H3,19,20,21,22) |
| InChIKey | RXJAKNKUVUOKOA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|