C17H24FNO5 — CID 8948709
(5-fluoro-2-methoxyphenyl)methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 8948709) has the molecular formula C17H24FNO5 and a molecular weight of 341.38 g/mol. Its IUPAC name is (5-fluoro-2-methoxyphenyl)methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | (5-fluoro-2-methoxyphenyl)methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 8948709 |
| Molecular Formula | C17H24FNO5 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | (5-fluoro-2-methoxyphenyl)methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | COc1ccc(F)cc1COC(=O)CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H24FNO5/c1-17(2,3)24-16(21)19-9-5-6-15(20)23-11-12-10-13(18)7-8-14(12)22-4/h7-8,10H,5-6,9,11H2,1-4H3,(H,19,21) |
| InChIKey | FBAHXDGIYUHFIE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|