C16H25FN2O3 — CID 146196773
tert-butyl N-[3-[2-[(1R)-1-aminoethyl]-4-fluorophenoxy]propyl]carbamate (PubChem CID 146196773) has the molecular formula C16H25FN2O3 and a molecular weight of 312.39 g/mol. Its IUPAC name is tert-butyl N-[3-[2-[(1R)-1-aminoethyl]-4-fluorophenoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-[(1R)-1-aminoethyl]-4-fluorophenoxy]propyl]carbamate |
|---|---|
| PubChem CID | 146196773 |
| Molecular Formula | C16H25FN2O3 |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | tert-butyl N-[3-[2-[(1R)-1-aminoethyl]-4-fluorophenoxy]propyl]carbamate |
| SMILES | C[C@@H](N)c1cc(F)ccc1OCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25FN2O3/c1-11(18)13-10-12(17)6-7-14(13)21-9-5-8-19-15(20)22-16(2,3)4/h6-7,10-11H,5,8-9,18H2,1-4H3,(H,19,20)/t11-/m1/s1 |
| InChIKey | RGTFRLIHFGYOHE-LLVKDONJSA-N |
| XLogP | 3.14 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|