C16H25FN2O3 — CID 133080612
tert-butyl N-[2-[2-[(1R)-1-aminoethyl]-4-fluorophenoxy]propyl]carbamate (PubChem CID 133080612) has the molecular formula C16H25FN2O3 and a molecular weight of 312.39 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[(1R)-1-aminoethyl]-4-fluorophenoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[(1R)-1-aminoethyl]-4-fluorophenoxy]propyl]carbamate |
|---|---|
| PubChem CID | 133080612 |
| Molecular Formula | C16H25FN2O3 |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | tert-butyl N-[2-[2-[(1R)-1-aminoethyl]-4-fluorophenoxy]propyl]carbamate |
| SMILES | CC(CNC(=O)OC(C)(C)C)Oc1ccc(F)cc1[C@@H](C)N |
| InChI | InChI=1S/C16H25FN2O3/c1-10(9-19-15(20)22-16(3,4)5)21-14-7-6-12(17)8-13(14)11(2)18/h6-8,10-11H,9,18H2,1-5H3,(H,19,20)/t10?,11-/m1/s1 |
| InChIKey | RQBLNMGEIXGIGR-RRKGBCIJSA-N |
| XLogP | 3.14 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |