C17H25FN2O3 — CID 153356613
tert-butyl N-[3-[2-[(1S)-1-aminoethyl]-4-fluorophenoxy]cyclobutyl]carbamate (PubChem CID 153356613) has the molecular formula C17H25FN2O3 and a molecular weight of 324.40 g/mol. Its IUPAC name is tert-butyl N-[3-[2-[(1S)-1-aminoethyl]-4-fluorophenoxy]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-[(1S)-1-aminoethyl]-4-fluorophenoxy]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 153356613 |
| Molecular Formula | C17H25FN2O3 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | tert-butyl N-[3-[2-[(1S)-1-aminoethyl]-4-fluorophenoxy]cyclobutyl]carbamate |
| SMILES | C[C@H](N)c1cc(F)ccc1OC1CC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H25FN2O3/c1-10(19)14-7-11(18)5-6-15(14)22-13-8-12(9-13)20-16(21)23-17(2,3)4/h5-7,10,12-13H,8-9,19H2,1-4H3,(H,20,21)/t10-,12?,13?/m0/s1 |
| InChIKey | WHMFEFDTHQVZSV-PKSQDBQZSA-N |
| XLogP | 3.28 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |