C17H24F2N2O2 — CID 107239164
tert-butyl N-[3-[1-(3,5-difluorophenyl)ethylamino]cyclobutyl]carbamate (PubChem CID 107239164) has the molecular formula C17H24F2N2O2 and a molecular weight of 326.39 g/mol. Its IUPAC name is tert-butyl N-[3-[1-(3,5-difluorophenyl)ethylamino]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[3-[1-(3,5-difluorophenyl)ethylamino]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 107239164 |
| Molecular Formula | C17H24F2N2O2 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | tert-butyl N-[3-[1-(3,5-difluorophenyl)ethylamino]cyclobutyl]carbamate |
| SMILES | CC(NC1CC(NC(=O)OC(C)(C)C)C1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C17H24F2N2O2/c1-10(11-5-12(18)7-13(19)6-11)20-14-8-15(9-14)21-16(22)23-17(2,3)4/h5-7,10,14-15,20H,8-9H2,1-4H3,(H,21,22) |
| InChIKey | IMHPRHPMRKNTPW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |