C17H24ClFN2O2 — CID 107239026
tert-butyl N-[3-[1-(3-chloro-4-fluorophenyl)ethylamino]cyclobutyl]carbamate (PubChem CID 107239026) has the molecular formula C17H24ClFN2O2 and a molecular weight of 342.84 g/mol. Its IUPAC name is tert-butyl N-[3-[1-(3-chloro-4-fluorophenyl)ethylamino]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[3-[1-(3-chloro-4-fluorophenyl)ethylamino]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 107239026 |
| Molecular Formula | C17H24ClFN2O2 |
| Molecular Weight | 342.84 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | tert-butyl N-[3-[1-(3-chloro-4-fluorophenyl)ethylamino]cyclobutyl]carbamate |
| SMILES | CC(NC1CC(NC(=O)OC(C)(C)C)C1)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C17H24ClFN2O2/c1-10(11-5-6-15(19)14(18)7-11)20-12-8-13(9-12)21-16(22)23-17(2,3)4/h5-7,10,12-13,20H,8-9H2,1-4H3,(H,21,22) |
| InChIKey | LSDRRSPIHYFVKU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.84 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |