C20H32N2O2 — CID 113263051
tert-butyl N-[3-[[(1S)-1-(4-methylphenyl)ethyl]amino]cyclohexyl]carbamate (PubChem CID 113263051) has the molecular formula C20H32N2O2 and a molecular weight of 332.49 g/mol. Its IUPAC name is tert-butyl N-[3-[[(1S)-1-(4-methylphenyl)ethyl]amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[3-[[(1S)-1-(4-methylphenyl)ethyl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 113263051 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | tert-butyl N-[3-[[(1S)-1-(4-methylphenyl)ethyl]amino]cyclohexyl]carbamate |
| SMILES | Cc1ccc([C@H](C)NC2CCCC(NC(=O)OC(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C20H32N2O2/c1-14-9-11-16(12-10-14)15(2)21-17-7-6-8-18(13-17)22-19(23)24-20(3,4)5/h9-12,15,17-18,21H,6-8,13H2,1-5H3,(H,22,23)/t15-,17?,18?/m0/s1 |
| InChIKey | CLPIWAOWVUNKEO-ZLPCBKJTSA-N |
| XLogP | 4.48 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |