C19H28F2N2O2 — CID 113247871
tert-butyl N-[3-[1-(2,5-difluorophenyl)ethylamino]cyclohexyl]carbamate (PubChem CID 113247871) has the molecular formula C19H28F2N2O2 and a molecular weight of 354.44 g/mol. Its IUPAC name is tert-butyl N-[3-[1-(2,5-difluorophenyl)ethylamino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[3-[1-(2,5-difluorophenyl)ethylamino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 113247871 |
| Molecular Formula | C19H28F2N2O2 |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | tert-butyl N-[3-[1-(2,5-difluorophenyl)ethylamino]cyclohexyl]carbamate |
| SMILES | CC(NC1CCCC(NC(=O)OC(C)(C)C)C1)c1cc(F)ccc1F |
| InChI | InChI=1S/C19H28F2N2O2/c1-12(16-10-13(20)8-9-17(16)21)22-14-6-5-7-15(11-14)23-18(24)25-19(2,3)4/h8-10,12,14-15,22H,5-7,11H2,1-4H3,(H,23,24) |
| InChIKey | CWIZHWWSXRBRTD-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |