C19H29FN2O2 — CID 113247851
tert-butyl N-[3-[1-(4-fluorophenyl)propan-2-ylamino]cyclopentyl]carbamate (PubChem CID 113247851) has the molecular formula C19H29FN2O2 and a molecular weight of 336.45 g/mol. Its IUPAC name is tert-butyl N-[3-[1-(4-fluorophenyl)propan-2-ylamino]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[3-[1-(4-fluorophenyl)propan-2-ylamino]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 113247851 |
| Molecular Formula | C19H29FN2O2 |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | tert-butyl N-[3-[1-(4-fluorophenyl)propan-2-ylamino]cyclopentyl]carbamate |
| SMILES | CC(Cc1ccc(F)cc1)NC1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H29FN2O2/c1-13(11-14-5-7-15(20)8-6-14)21-16-9-10-17(12-16)22-18(23)24-19(2,3)4/h5-8,13,16-17,21H,9-12H2,1-4H3,(H,22,23) |
| InChIKey | VKDWQDKUEWPJDK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |