C16H24FNS — CID 103787278
3-ethylsulfanyl-N-[1-(4-fluorophenyl)propan-2-yl]cyclopentan-1-amine (PubChem CID 103787278) has the molecular formula C16H24FNS and a molecular weight of 281.44 g/mol. Its IUPAC name is 3-ethylsulfanyl-N-[1-(4-fluorophenyl)propan-2-yl]cyclopentan-1-amine.
| Compound Name | 3-ethylsulfanyl-N-[1-(4-fluorophenyl)propan-2-yl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 103787278 |
| Molecular Formula | C16H24FNS |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 3-ethylsulfanyl-N-[1-(4-fluorophenyl)propan-2-yl]cyclopentan-1-amine |
| SMILES | CCSC1CCC(NC(C)Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C16H24FNS/c1-3-19-16-9-8-15(11-16)18-12(2)10-13-4-6-14(17)7-5-13/h4-7,12,15-16,18H,3,8-11H2,1-2H3 |
| InChIKey | OQJWQOGGMVMVDZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |