C12H15ClFNO — CID 80717161
N-[1-(3-chloro-4-fluorophenyl)ethyl]oxolan-3-amine (PubChem CID 80717161) has the molecular formula C12H15ClFNO and a molecular weight of 243.71 g/mol. Its IUPAC name is N-[1-(3-chloro-4-fluorophenyl)ethyl]oxolan-3-amine.
| Compound Name | N-[1-(3-chloro-4-fluorophenyl)ethyl]oxolan-3-amine |
|---|---|
| PubChem CID | 80717161 |
| Molecular Formula | C12H15ClFNO |
| Molecular Weight | 243.71 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | N-[1-(3-chloro-4-fluorophenyl)ethyl]oxolan-3-amine |
| SMILES | CC(NC1CCOC1)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C12H15ClFNO/c1-8(15-10-4-5-16-7-10)9-2-3-12(14)11(13)6-9/h2-3,6,8,10,15H,4-5,7H2,1H3 |
| InChIKey | ZSTONGYJCYBJFQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.71 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |