C17H25BrN2O2 — CID 103791631
tert-butyl N-[3-[[(1R)-1-(3-bromophenyl)ethyl]amino]cyclobutyl]carbamate (PubChem CID 103791631) has the molecular formula C17H25BrN2O2 and a molecular weight of 369.30 g/mol. Its IUPAC name is tert-butyl N-[3-[[(1R)-1-(3-bromophenyl)ethyl]amino]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[3-[[(1R)-1-(3-bromophenyl)ethyl]amino]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 103791631 |
| Molecular Formula | C17H25BrN2O2 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | tert-butyl N-[3-[[(1R)-1-(3-bromophenyl)ethyl]amino]cyclobutyl]carbamate |
| SMILES | C[C@@H](NC1CC(NC(=O)OC(C)(C)C)C1)c1cccc(Br)c1 |
| InChI | InChI=1S/C17H25BrN2O2/c1-11(12-6-5-7-13(18)8-12)19-14-9-15(10-14)20-16(21)22-17(2,3)4/h5-8,11,14-15,19H,9-10H2,1-4H3,(H,20,21)/t11-,14?,15?/m1/s1 |
| InChIKey | VNQVAIRGSUCHHY-VCANKDNSSA-N |
| XLogP | 4.16 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |