C17H27BrN2O2 — CID 107250353
tert-butyl N-[1-[1-(3-bromophenyl)ethylamino]butan-2-yl]carbamate (PubChem CID 107250353) has the molecular formula C17H27BrN2O2 and a molecular weight of 371.32 g/mol. Its IUPAC name is tert-butyl N-[1-[1-(3-bromophenyl)ethylamino]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[1-(3-bromophenyl)ethylamino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 107250353 |
| Molecular Formula | C17H27BrN2O2 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | tert-butyl N-[1-[1-(3-bromophenyl)ethylamino]butan-2-yl]carbamate |
| SMILES | CCC(CNC(C)c1cccc(Br)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H27BrN2O2/c1-6-15(20-16(21)22-17(3,4)5)11-19-12(2)13-8-7-9-14(18)10-13/h7-10,12,15,19H,6,11H2,1-5H3,(H,20,21) |
| InChIKey | STGLPOZHNMMMFW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |