C20H23BrN2O3 — CID 55575237
tert-butyl N-[4-[1-(3-bromophenyl)ethylcarbamoyl]phenyl]carbamate (PubChem CID 55575237) has the molecular formula C20H23BrN2O3 and a molecular weight of 419.32 g/mol. Its IUPAC name is tert-butyl N-[4-[1-(3-bromophenyl)ethylcarbamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[1-(3-bromophenyl)ethylcarbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 55575237 |
| Molecular Formula | C20H23BrN2O3 |
| Molecular Weight | 419.32 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | tert-butyl N-[4-[1-(3-bromophenyl)ethylcarbamoyl]phenyl]carbamate |
| SMILES | CC(NC(=O)c1ccc(NC(=O)OC(C)(C)C)cc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C20H23BrN2O3/c1-13(15-6-5-7-16(21)12-15)22-18(24)14-8-10-17(11-9-14)23-19(25)26-20(2,3)4/h5-13H,1-4H3,(H,22,24)(H,23,25) |
| InChIKey | YPKLXOCMCOTJCW-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.32 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |