C22H28N2O4 — CID 9264258
tert-butyl N-[4-[[(1R)-1-(2-methoxy-5-methylphenyl)ethyl]carbamoyl]phenyl]carbamate (PubChem CID 9264258) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is tert-butyl N-[4-[[(1R)-1-(2-methoxy-5-methylphenyl)ethyl]carbamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[[(1R)-1-(2-methoxy-5-methylphenyl)ethyl]carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 9264258 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | tert-butyl N-[4-[[(1R)-1-(2-methoxy-5-methylphenyl)ethyl]carbamoyl]phenyl]carbamate |
| SMILES | COc1ccc(C)cc1[C@@H](C)NC(=O)c1ccc(NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H28N2O4/c1-14-7-12-19(27-6)18(13-14)15(2)23-20(25)16-8-10-17(11-9-16)24-21(26)28-22(3,4)5/h7-13,15H,1-6H3,(H,23,25)(H,24,26)/t15-/m1/s1 |
| InChIKey | LRBPHTXIRFQEKB-OAHLLOKOSA-N |
| XLogP | 4.84 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |