C18H22N2O4S — CID 42120084
4-(methanesulfonamido)-N-[(1S)-1-(2-methoxy-5-methylphenyl)ethyl]benzamide (PubChem CID 42120084) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is 4-(methanesulfonamido)-N-[(1S)-1-(2-methoxy-5-methylphenyl)ethyl]benzamide.
| Compound Name | 4-(methanesulfonamido)-N-[(1S)-1-(2-methoxy-5-methylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 42120084 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 4-(methanesulfonamido)-N-[(1S)-1-(2-methoxy-5-methylphenyl)ethyl]benzamide |
| SMILES | COc1ccc(C)cc1[C@H](C)NC(=O)c1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H22N2O4S/c1-12-5-10-17(24-3)16(11-12)13(2)19-18(21)14-6-8-15(9-7-14)20-25(4,22)23/h5-11,13,20H,1-4H3,(H,19,21)/t13-/m0/s1 |
| InChIKey | UYHLSPNVELLPTC-ZDUSSCGKSA-N |
| XLogP | 2.87 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |