C19H23NO2 — CID 84966349
N-[1-(2-methoxy-5-methylphenyl)ethyl]-3,4-dimethylbenzamide (PubChem CID 84966349) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is N-[1-(2-methoxy-5-methylphenyl)ethyl]-3,4-dimethylbenzamide.
| Compound Name | N-[1-(2-methoxy-5-methylphenyl)ethyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 84966349 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-[1-(2-methoxy-5-methylphenyl)ethyl]-3,4-dimethylbenzamide |
| SMILES | COc1ccc(C)cc1C(C)NC(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C19H23NO2/c1-12-6-9-18(22-5)17(10-12)15(4)20-19(21)16-8-7-13(2)14(3)11-16/h6-11,15H,1-5H3,(H,20,21) |
| InChIKey | SNMSPIDKWWPMGV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |