C17H26BrFN2O2 — CID 107250497
tert-butyl N-[1-[1-(4-bromo-2-fluorophenyl)ethylamino]butan-2-yl]carbamate (PubChem CID 107250497) has the molecular formula C17H26BrFN2O2 and a molecular weight of 389.31 g/mol. Its IUPAC name is tert-butyl N-[1-[1-(4-bromo-2-fluorophenyl)ethylamino]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[1-(4-bromo-2-fluorophenyl)ethylamino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 107250497 |
| Molecular Formula | C17H26BrFN2O2 |
| Molecular Weight | 389.31 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | tert-butyl N-[1-[1-(4-bromo-2-fluorophenyl)ethylamino]butan-2-yl]carbamate |
| SMILES | CCC(CNC(C)c1ccc(Br)cc1F)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H26BrFN2O2/c1-6-13(21-16(22)23-17(3,4)5)10-20-11(2)14-8-7-12(18)9-15(14)19/h7-9,11,13,20H,6,10H2,1-5H3,(H,21,22) |
| InChIKey | YMGARNTYRWQONX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.31 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |