C17H27FN2O3 — CID 107715517
tert-butyl N-[4-[1-(2-fluoro-4-hydroxyphenyl)ethylamino]butan-2-yl]carbamate (PubChem CID 107715517) has the molecular formula C17H27FN2O3 and a molecular weight of 326.41 g/mol. Its IUPAC name is tert-butyl N-[4-[1-(2-fluoro-4-hydroxyphenyl)ethylamino]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[1-(2-fluoro-4-hydroxyphenyl)ethylamino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 107715517 |
| Molecular Formula | C17H27FN2O3 |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | tert-butyl N-[4-[1-(2-fluoro-4-hydroxyphenyl)ethylamino]butan-2-yl]carbamate |
| SMILES | CC(CCNC(C)c1ccc(O)cc1F)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H27FN2O3/c1-11(20-16(22)23-17(3,4)5)8-9-19-12(2)14-7-6-13(21)10-15(14)18/h6-7,10-12,19,21H,8-9H2,1-5H3,(H,20,22) |
| InChIKey | VJLHXDQOEFZOTQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |