C15H24FNO — CID 107715334
3-fluoro-4-[1-(5-methylhexylamino)ethyl]phenol (PubChem CID 107715334) has the molecular formula C15H24FNO and a molecular weight of 253.36 g/mol. Its IUPAC name is 3-fluoro-4-[1-(5-methylhexylamino)ethyl]phenol.
| Compound Name | 3-fluoro-4-[1-(5-methylhexylamino)ethyl]phenol |
|---|---|
| PubChem CID | 107715334 |
| Molecular Formula | C15H24FNO |
| Molecular Weight | 253.36 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 3-fluoro-4-[1-(5-methylhexylamino)ethyl]phenol |
| SMILES | CC(C)CCCCNC(C)c1ccc(O)cc1F |
| InChI | InChI=1S/C15H24FNO/c1-11(2)6-4-5-9-17-12(3)14-8-7-13(18)10-15(14)16/h7-8,10-12,17-18H,4-6,9H2,1-3H3 |
| InChIKey | ZNTBRKNCPGKEGW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|