C17H26FN3O2 — CID 162353304
tert-butyl N-[[1-[2-[(1R)-1-aminoethyl]-4-fluorophenyl]azetidin-2-yl]methyl]carbamate (PubChem CID 162353304) has the molecular formula C17H26FN3O2 and a molecular weight of 323.41 g/mol. Its IUPAC name is tert-butyl N-[[1-[2-[(1R)-1-aminoethyl]-4-fluorophenyl]azetidin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-[2-[(1R)-1-aminoethyl]-4-fluorophenyl]azetidin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 162353304 |
| Molecular Formula | C17H26FN3O2 |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | tert-butyl N-[[1-[2-[(1R)-1-aminoethyl]-4-fluorophenyl]azetidin-2-yl]methyl]carbamate |
| SMILES | C[C@@H](N)c1cc(F)ccc1N1CCC1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H26FN3O2/c1-11(19)14-9-12(18)5-6-15(14)21-8-7-13(21)10-20-16(22)23-17(2,3)4/h5-6,9,11,13H,7-8,10,19H2,1-4H3,(H,20,22)/t11-,13?/m1/s1 |
| InChIKey | CSXMAHWEEBMQBY-JTDNENJMSA-N |
| XLogP | 2.95 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |