C20H30FN3O3S — CID 175171463
tert-butyl-[[5-fluoro-2-[(2R)-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]azetidin-1-yl]phenyl]methylideneamino]-oxidosulfanium (PubChem CID 175171463) has the molecular formula C20H30FN3O3S and a molecular weight of 411.54 g/mol. Its IUPAC name is tert-butyl-[[5-fluoro-2-[(2R)-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]azetidin-1-yl]phenyl]methylideneamino]-oxidosulfanium.
| Compound Name | tert-butyl-[[5-fluoro-2-[(2R)-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]azetidin-1-yl]phenyl]methylideneamino]-oxidosulfanium |
|---|---|
| PubChem CID | 175171463 |
| Molecular Formula | C20H30FN3O3S |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | tert-butyl-[[5-fluoro-2-[(2R)-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]azetidin-1-yl]phenyl]methylideneamino]-oxidosulfanium |
| SMILES | CC(C)(C)OC(=O)NC[C@H]1CCN1c1ccc(F)cc1C=N[S+]([O-])C(C)(C)C |
| InChI | InChI=1S/C20H30FN3O3S/c1-19(2,3)27-18(25)22-13-16-9-10-24(16)17-8-7-15(21)11-14(17)12-23-28(26)20(4,5)6/h7-8,11-12,16H,9-10,13H2,1-6H3,(H,22,25)/t16-,28?/m1/s1 |
| InChIKey | UAVPROPFFOOEBS-NFXOVVRFSA-N |
| XLogP | 3.81 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|