C9H16FNO2 — CID 178194635
tert-butyl N-[[(1R,2R)-2-fluorocyclopropyl]methyl]carbamate (PubChem CID 178194635) has the molecular formula C9H16FNO2 and a molecular weight of 189.23 g/mol. Its IUPAC name is tert-butyl N-[[(1R,2R)-2-fluorocyclopropyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(1R,2R)-2-fluorocyclopropyl]methyl]carbamate |
|---|---|
| PubChem CID | 178194635 |
| Molecular Formula | C9H16FNO2 |
| Molecular Weight | 189.23 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | tert-butyl N-[[(1R,2R)-2-fluorocyclopropyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@H]1C[C@H]1F |
| InChI | InChI=1S/C9H16FNO2/c1-9(2,3)13-8(12)11-5-6-4-7(6)10/h6-7H,4-5H2,1-3H3,(H,11,12)/t6-,7-/m1/s1 |
| InChIKey | OBTGIMMQFVKMIP-RNFRBKRXSA-N |
| XLogP | 1.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |