C11H20BrNO2 — CID 114313805
tert-butyl N-[(2-bromocyclopentyl)methyl]carbamate (PubChem CID 114313805) has the molecular formula C11H20BrNO2 and a molecular weight of 278.19 g/mol. Its IUPAC name is tert-butyl N-[(2-bromocyclopentyl)methyl]carbamate.
| Compound Name | tert-butyl N-[(2-bromocyclopentyl)methyl]carbamate |
|---|---|
| PubChem CID | 114313805 |
| Molecular Formula | C11H20BrNO2 |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | tert-butyl N-[(2-bromocyclopentyl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCCC1Br |
| InChI | InChI=1S/C11H20BrNO2/c1-11(2,3)15-10(14)13-7-8-5-4-6-9(8)12/h8-9H,4-7H2,1-3H3,(H,13,14) |
| InChIKey | GILGLYXAEGTVGV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|