C14H28N4O3 — CID 83112671
tert-butyl N-[[2-[2-(carbamoylamino)ethylamino]cyclopentyl]methyl]carbamate (PubChem CID 83112671) has the molecular formula C14H28N4O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is tert-butyl N-[[2-[2-(carbamoylamino)ethylamino]cyclopentyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-[2-(carbamoylamino)ethylamino]cyclopentyl]methyl]carbamate |
|---|---|
| PubChem CID | 83112671 |
| Molecular Formula | C14H28N4O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | tert-butyl N-[[2-[2-(carbamoylamino)ethylamino]cyclopentyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCCC1NCCNC(N)=O |
| InChI | InChI=1S/C14H28N4O3/c1-14(2,3)21-13(20)18-9-10-5-4-6-11(10)16-7-8-17-12(15)19/h10-11,16H,4-9H2,1-3H3,(H,18,20)(H3,15,17,19) |
| InChIKey | YDKHLYSCQRLFPS-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|