C15H30N2O3S — CID 115972016
tert-butyl N-[[2-(3-methylsulfinylpropylamino)cyclopentyl]methyl]carbamate (PubChem CID 115972016) has the molecular formula C15H30N2O3S and a molecular weight of 318.48 g/mol. Its IUPAC name is tert-butyl N-[[2-(3-methylsulfinylpropylamino)cyclopentyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-(3-methylsulfinylpropylamino)cyclopentyl]methyl]carbamate |
|---|---|
| PubChem CID | 115972016 |
| Molecular Formula | C15H30N2O3S |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | tert-butyl N-[[2-(3-methylsulfinylpropylamino)cyclopentyl]methyl]carbamate |
| SMILES | CS(=O)CCCNC1CCCC1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H30N2O3S/c1-15(2,3)20-14(18)17-11-12-7-5-8-13(12)16-9-6-10-21(4)19/h12-13,16H,5-11H2,1-4H3,(H,17,18) |
| InChIKey | VQONEDIEOLHTJX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|