C19H38N2O4 — CID 113356854
tert-butyl N-[[2-[4-(2-methoxyethoxy)butylamino]cyclohexyl]methyl]carbamate (PubChem CID 113356854) has the molecular formula C19H38N2O4 and a molecular weight of 358.52 g/mol. Its IUPAC name is tert-butyl N-[[2-[4-(2-methoxyethoxy)butylamino]cyclohexyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-[4-(2-methoxyethoxy)butylamino]cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 113356854 |
| Molecular Formula | C19H38N2O4 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.28 |
| IUPAC Name | tert-butyl N-[[2-[4-(2-methoxyethoxy)butylamino]cyclohexyl]methyl]carbamate |
| SMILES | COCCOCCCCNC1CCCCC1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H38N2O4/c1-19(2,3)25-18(22)21-15-16-9-5-6-10-17(16)20-11-7-8-12-24-14-13-23-4/h16-17,20H,5-15H2,1-4H3,(H,21,22) |
| InChIKey | FAVPUPOWCATDOV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|