C11H20F2N2O2 — CID 130800949
tert-butyl N-[[4-(difluoromethyl)pyrrolidin-3-yl]methyl]carbamate (PubChem CID 130800949) has the molecular formula C11H20F2N2O2 and a molecular weight of 250.29 g/mol. Its IUPAC name is tert-butyl N-[[4-(difluoromethyl)pyrrolidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-(difluoromethyl)pyrrolidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 130800949 |
| Molecular Formula | C11H20F2N2O2 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | tert-butyl N-[[4-(difluoromethyl)pyrrolidin-3-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CNCC1C(F)F |
| InChI | InChI=1S/C11H20F2N2O2/c1-11(2,3)17-10(16)15-5-7-4-14-6-8(7)9(12)13/h7-9,14H,4-6H2,1-3H3,(H,15,16) |
| InChIKey | QSZBYVPUQPDELL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |