C18H24N4O4 — CID 133397105
tert-butyl N-[[1-(4-cyano-2-nitrophenyl)piperidin-2-yl]methyl]carbamate (PubChem CID 133397105) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is tert-butyl N-[[1-(4-cyano-2-nitrophenyl)piperidin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-(4-cyano-2-nitrophenyl)piperidin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 133397105 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | tert-butyl N-[[1-(4-cyano-2-nitrophenyl)piperidin-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCCCN1c1ccc(C#N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H24N4O4/c1-18(2,3)26-17(23)20-12-14-6-4-5-9-21(14)15-8-7-13(11-19)10-16(15)22(24)25/h7-8,10,14H,4-6,9,12H2,1-3H3,(H,20,23) |
| InChIKey | YSVWHZNLCMRYRQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 108.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|