C19H27N3O2 — CID 60602632
tert-butyl N-[[1-[(3-cyanophenyl)methyl]piperidin-2-yl]methyl]carbamate (PubChem CID 60602632) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is tert-butyl N-[[1-[(3-cyanophenyl)methyl]piperidin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-[(3-cyanophenyl)methyl]piperidin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 60602632 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | tert-butyl N-[[1-[(3-cyanophenyl)methyl]piperidin-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCCCN1Cc1cccc(C#N)c1 |
| InChI | InChI=1S/C19H27N3O2/c1-19(2,3)24-18(23)21-13-17-9-4-5-10-22(17)14-16-8-6-7-15(11-16)12-20/h6-8,11,17H,4-5,9-10,13-14H2,1-3H3,(H,21,23) |
| InChIKey | HYINKJRDJJSGFA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |