C13H13N3O4 — CID 62006998
methyl 1-(4-cyano-2-nitrophenyl)pyrrolidine-2-carboxylate (PubChem CID 62006998) has the molecular formula C13H13N3O4 and a molecular weight of 275.26 g/mol. Its IUPAC name is methyl 1-(4-cyano-2-nitrophenyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-(4-cyano-2-nitrophenyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 62006998 |
| Molecular Formula | C13H13N3O4 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | methyl 1-(4-cyano-2-nitrophenyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1c1ccc(C#N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H13N3O4/c1-20-13(17)11-3-2-6-15(11)10-5-4-9(8-14)7-12(10)16(18)19/h4-5,7,11H,2-3,6H2,1H3 |
| InChIKey | IIQFISDHTMRIGS-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 96.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|