C16H21FN2O3 — CID 162353310
tert-butyl N-[[1-(4-fluoro-2-formylphenyl)azetidin-2-yl]methyl]carbamate (PubChem CID 162353310) has the molecular formula C16H21FN2O3 and a molecular weight of 308.35 g/mol. Its IUPAC name is tert-butyl N-[[1-(4-fluoro-2-formylphenyl)azetidin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-(4-fluoro-2-formylphenyl)azetidin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 162353310 |
| Molecular Formula | C16H21FN2O3 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | tert-butyl N-[[1-(4-fluoro-2-formylphenyl)azetidin-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCN1c1ccc(F)cc1C=O |
| InChI | InChI=1S/C16H21FN2O3/c1-16(2,3)22-15(21)18-9-13-6-7-19(13)14-5-4-12(17)8-11(14)10-20/h4-5,8,10,13H,6-7,9H2,1-3H3,(H,18,21) |
| InChIKey | ATUYJPXDZAAFTJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|