C13H18FN3O2 — CID 175168258
[1-[2-[(1R)-1-aminoethyl]-4-fluorophenyl]azetidin-2-yl]methyl carbamate (PubChem CID 175168258) has the molecular formula C13H18FN3O2 and a molecular weight of 267.30 g/mol. Its IUPAC name is [1-[2-[(1R)-1-aminoethyl]-4-fluorophenyl]azetidin-2-yl]methyl carbamate.
| Compound Name | [1-[2-[(1R)-1-aminoethyl]-4-fluorophenyl]azetidin-2-yl]methyl carbamate |
|---|---|
| PubChem CID | 175168258 |
| Molecular Formula | C13H18FN3O2 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | [1-[2-[(1R)-1-aminoethyl]-4-fluorophenyl]azetidin-2-yl]methyl carbamate |
| SMILES | C[C@@H](N)c1cc(F)ccc1N1CCC1COC(N)=O |
| InChI | InChI=1S/C13H18FN3O2/c1-8(15)11-6-9(14)2-3-12(11)17-5-4-10(17)7-19-13(16)18/h2-3,6,8,10H,4-5,7,15H2,1H3,(H2,16,18)/t8-,10?/m1/s1 |
| InChIKey | ANSDVKKBCSLEAA-HNHGDDPOSA-N |
| XLogP | 1.52 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |