C16H23F2NO3 — CID 142279103
tert-butyl N-[2-(2-ethyl-4,6-difluorophenoxy)propyl]carbamate (PubChem CID 142279103) has the molecular formula C16H23F2NO3 and a molecular weight of 315.36 g/mol. Its IUPAC name is tert-butyl N-[2-(2-ethyl-4,6-difluorophenoxy)propyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-ethyl-4,6-difluorophenoxy)propyl]carbamate |
|---|---|
| PubChem CID | 142279103 |
| Molecular Formula | C16H23F2NO3 |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | tert-butyl N-[2-(2-ethyl-4,6-difluorophenoxy)propyl]carbamate |
| SMILES | CCc1cc(F)cc(F)c1OC(C)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H23F2NO3/c1-6-11-7-12(17)8-13(18)14(11)21-10(2)9-19-15(20)22-16(3,4)5/h7-8,10H,6,9H2,1-5H3,(H,19,20) |
| InChIKey | UHVIDEYDRKAHJI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |