C14H22FN3O3 — CID 175364559
tert-butyl N-[2-[[3-(aminomethyl)-5-fluoro-2-pyridinyl]oxy]propyl]carbamate (PubChem CID 175364559) has the molecular formula C14H22FN3O3 and a molecular weight of 299.35 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-(aminomethyl)-5-fluoro-2-pyridinyl]oxy]propyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-(aminomethyl)-5-fluoro-2-pyridinyl]oxy]propyl]carbamate |
|---|---|
| PubChem CID | 175364559 |
| Molecular Formula | C14H22FN3O3 |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | tert-butyl N-[2-[[3-(aminomethyl)-5-fluoro-2-pyridinyl]oxy]propyl]carbamate |
| SMILES | CC(CNC(=O)OC(C)(C)C)Oc1ncc(F)cc1CN |
| InChI | InChI=1S/C14H22FN3O3/c1-9(7-18-13(19)21-14(2,3)4)20-12-10(6-16)5-11(15)8-17-12/h5,8-9H,6-7,16H2,1-4H3,(H,18,19) |
| InChIKey | CMEXEIVNYOJIQR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |