C14H20F2N2O4 — CID 170832195
tert-butyl N-[3-(4-amino-2,5-difluorophenyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 170832195) has the molecular formula C14H20F2N2O4 and a molecular weight of 318.32 g/mol. Its IUPAC name is tert-butyl N-[3-(4-amino-2,5-difluorophenyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-amino-2,5-difluorophenyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 170832195 |
| Molecular Formula | C14H20F2N2O4 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | tert-butyl N-[3-(4-amino-2,5-difluorophenyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(O)C(O)c1cc(F)c(N)cc1F |
| InChI | InChI=1S/C14H20F2N2O4/c1-14(2,3)22-13(21)18-6-11(19)12(20)7-4-9(16)10(17)5-8(7)15/h4-5,11-12,19-20H,6,17H2,1-3H3,(H,18,21) |
| InChIKey | HWGZYQVRFVEQDN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|